About 4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide
4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide (PubChem CID 10041052) has the molecular formula C19H19FN2O
and a molecular weight of 310.37 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide.
Molecular Properties
| Compound Name | 4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide |
| PubChem CID | 10041052 |
| Molecular Formula | C19H19FN2O |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide |
| SMILES | CN(C)C(=O)N1CC(c2ccccc2F)=CC1c1ccccc1 |
| InChI | InChI=1S/C19H19FN2O/c1-21(2)19(23)22-13-15(16-10-6-7-11-17(16)20)12-18(22)14-8-4-3-5-9-14/h3-12,18H,13H2,1-2H3 |
| InChIKey | BRGDRIVCZGPSJC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide?
The IUPAC name of 4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide (CID 10041052) is 4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide.
What is the SMILES notation for 4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide?
The canonical SMILES for 4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide is CN(C)C(=O)N1CC(c2ccccc2F)=CC1c1ccccc1.
What is the InChIKey of 4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide?
The InChIKey is BRGDRIVCZGPSJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN2O/c1-21(2)19(23)22-13-15(16-10-6-7-11-17(16)20)12-18(22)14-8-4-3-5-9-14/h3-12,18H,13H2,1-2H3.
What are the key properties of 4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide?
4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide has a molecular weight of 310.37 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluorophenyl)-N,N-dimethyl-2-phenyl-2,5-dihydropyrrole-1-carboxamide is sourced from PubChem (CID 10041052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).