C18H22N4O — CID 10041061
(5E)-1,3-diethyl-5-[(1-ethylindol-3-yl)methylidene]-2-iminoimidazolidin-4-one (PubChem CID 10041061) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is (5E)-1,3-diethyl-5-[(1-ethylindol-3-yl)methylidene]-2-iminoimidazolidin-4-one.
| Compound Name | (5E)-1,3-diethyl-5-[(1-ethylindol-3-yl)methylidene]-2-iminoimidazolidin-4-one |
|---|---|
| PubChem CID | 10041061 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (5E)-1,3-diethyl-5-[(1-ethylindol-3-yl)methylidene]-2-iminoimidazolidin-4-one |
| SMILES | [H]/N=C1\N(CC)C(=O)/C(=C\c2cn(CC)c3ccccc23)N1CC |
| InChI | InChI=1S/C18H22N4O/c1-4-20-12-13(14-9-7-8-10-15(14)20)11-16-17(23)22(6-3)18(19)21(16)5-2/h7-12,19H,4-6H2,1-3H3/b16-11+,19-18- |
| InChIKey | LMHIJLMRTWWPTQ-BDYZYUDZSA-N |
| XLogP | 3.12 |
| TPSA | 52.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|