C20H26N2O — CID 10041075
3-[(3R,4R)-3,4-dimethyl-1-(2-pyridin-4-ylethyl)piperidin-4-yl]phenol (PubChem CID 10041075) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-[(3R,4R)-3,4-dimethyl-1-(2-pyridin-4-ylethyl)piperidin-4-yl]phenol.
| Compound Name | 3-[(3R,4R)-3,4-dimethyl-1-(2-pyridin-4-ylethyl)piperidin-4-yl]phenol |
|---|---|
| PubChem CID | 10041075 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 3-[(3R,4R)-3,4-dimethyl-1-(2-pyridin-4-ylethyl)piperidin-4-yl]phenol |
| SMILES | C[C@H]1CN(CCc2ccncc2)CC[C@@]1(C)c1cccc(O)c1 |
| InChI | InChI=1S/C20H26N2O/c1-16-15-22(12-8-17-6-10-21-11-7-17)13-9-20(16,2)18-4-3-5-19(23)14-18/h3-7,10-11,14,16,23H,8-9,12-13,15H2,1-2H3/t16-,20+/m0/s1 |
| InChIKey | YLLIUYYFNJRSBX-OXJNMPFZSA-N |
| XLogP | 3.63 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |