C21H18ClN3O2 — CID 1004128
(5E)-3-(3-chlorophenyl)-5-[(1-propan-2-ylindol-3-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 1004128) has the molecular formula C21H18ClN3O2 and a molecular weight of 379.85 g/mol. Its IUPAC name is (5E)-3-(3-chlorophenyl)-5-[(1-propan-2-ylindol-3-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-(3-chlorophenyl)-5-[(1-propan-2-ylindol-3-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 1004128 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | (5E)-3-(3-chlorophenyl)-5-[(1-propan-2-ylindol-3-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | CC(C)n1cc(/C=C2/NC(=O)N(c3cccc(Cl)c3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C21H18ClN3O2/c1-13(2)24-12-14(17-8-3-4-9-19(17)24)10-18-20(26)25(21(27)23-18)16-7-5-6-15(22)11-16/h3-13H,1-2H3,(H,23,27)/b18-10+ |
| InChIKey | FYOSNPKGMBQCGF-VCHYOVAHSA-N |
| XLogP | 4.97 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|