C17H30O5 — CID 10041347
dimethyl (2S,3S,5S)-3-nonyloxolane-2,5-dicarboxylate (PubChem CID 10041347) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is dimethyl (2S,3S,5S)-3-nonyloxolane-2,5-dicarboxylate.
| Compound Name | dimethyl (2S,3S,5S)-3-nonyloxolane-2,5-dicarboxylate |
|---|---|
| PubChem CID | 10041347 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | dimethyl (2S,3S,5S)-3-nonyloxolane-2,5-dicarboxylate |
| SMILES | CCCCCCCCC[C@H]1C[C@@H](C(=O)OC)O[C@@H]1C(=O)OC |
| InChI | InChI=1S/C17H30O5/c1-4-5-6-7-8-9-10-11-13-12-14(16(18)20-2)22-15(13)17(19)21-3/h13-15H,4-12H2,1-3H3/t13-,14-,15-/m0/s1 |
| InChIKey | MYPOUZKEKXXPCJ-KKUMJFAQSA-N |
| XLogP | 3.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|