About 1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea
1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea (PubChem CID 10041405) has the molecular formula C10H9N3O3S3
and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea.
Molecular Properties
| Compound Name | 1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea |
| PubChem CID | 10041405 |
| Molecular Formula | C10H9N3O3S3 |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | 1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea |
| SMILES | O=C(NN1C(=O)CSC1=S)NS(=O)c1ccccc1 |
| InChI | InChI=1S/C10H9N3O3S3/c14-8-6-18-10(17)13(8)11-9(15)12-19(16)7-4-2-1-3-5-7/h1-5H,6H2,(H2,11,12,15) |
| InChIKey | GKUSQSMUDMDTED-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea?
The IUPAC name of 1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea (CID 10041405) is 1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea.
What is the SMILES notation for 1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea?
The canonical SMILES for 1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea is O=C(NN1C(=O)CSC1=S)NS(=O)c1ccccc1.
What is the InChIKey of 1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea?
The InChIKey is GKUSQSMUDMDTED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O3S3/c14-8-6-18-10(17)13(8)11-9(15)12-19(16)7-4-2-1-3-5-7/h1-5H,6H2,(H2,11,12,15).
What are the key properties of 1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea?
1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea has a molecular weight of 315.40 g/mol, XLogP of 0.78, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfinyl)-3-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)urea is sourced from PubChem (CID 10041405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).