C16H19NO6 — CID 10041729
diethyl (1R,2R,6R,7S)-4,5-dioxo-3-azatricyclo[5.4.0.02,6]undec-10-ene-2,6-dicarboxylate (PubChem CID 10041729) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is diethyl (1R,2R,6R,7S)-4,5-dioxo-3-azatricyclo[5.4.0.02,6]undec-10-ene-2,6-dicarboxylate.
| Compound Name | diethyl (1R,2R,6R,7S)-4,5-dioxo-3-azatricyclo[5.4.0.02,6]undec-10-ene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 10041729 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | diethyl (1R,2R,6R,7S)-4,5-dioxo-3-azatricyclo[5.4.0.02,6]undec-10-ene-2,6-dicarboxylate |
| SMILES | CCOC(=O)[C@@]12C(=O)C(=O)N[C@]1(C(=O)OCC)[C@@H]1C=CCC[C@@H]12 |
| InChI | InChI=1S/C16H19NO6/c1-3-22-13(20)15-9-7-5-6-8-10(9)16(15,14(21)23-4-2)17-12(19)11(15)18/h6,8-10H,3-5,7H2,1-2H3,(H,17,19)/t9-,10+,15+,16-/m0/s1 |
| InChIKey | HKRABZOJOYSEJV-HRZBSETHSA-N |
| XLogP | 0.13 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|