About 2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one
2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one (PubChem CID 10041877) has the molecular formula C20H21NO3
and a molecular weight of 323.39 g/mol. Its IUPAC name is 2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one.
Molecular Properties
| Compound Name | 2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one |
| PubChem CID | 10041877 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one |
| SMILES | CCc1c2cc(OC)c(OC)cc2cc(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H21NO3/c1-4-17-16-12-19(24-3)18(23-2)10-15(16)11-20(22)21(17)13-14-8-6-5-7-9-14/h5-12H,4,13H2,1-3H3 |
| InChIKey | PONHVVGNWXCWSX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one?
The IUPAC name of 2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one (CID 10041877) is 2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one.
What is the SMILES notation for 2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one?
The canonical SMILES for 2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one is CCc1c2cc(OC)c(OC)cc2cc(=O)n1Cc1ccccc1.
What is the InChIKey of 2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one?
The InChIKey is PONHVVGNWXCWSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO3/c1-4-17-16-12-19(24-3)18(23-2)10-15(16)11-20(22)21(17)13-14-8-6-5-7-9-14/h5-12H,4,13H2,1-3H3.
What are the key properties of 2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one?
2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one has a molecular weight of 323.39 g/mol, XLogP of 3.63, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1-ethyl-6,7-dimethoxyisoquinolin-3-one is sourced from PubChem (CID 10041877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).