C13H15F3O4S — CID 10041913
(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)methyl trifluoromethanesulfonate (PubChem CID 10041913) has the molecular formula C13H15F3O4S and a molecular weight of 324.32 g/mol. Its IUPAC name is (6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)methyl trifluoromethanesulfonate.
| Compound Name | (6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10041913 |
| Molecular Formula | C13H15F3O4S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | (6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)methyl trifluoromethanesulfonate |
| SMILES | COc1ccc2c(c1)CCC(COS(=O)(=O)C(F)(F)F)C2 |
| InChI | InChI=1S/C13H15F3O4S/c1-19-12-5-4-10-6-9(2-3-11(10)7-12)8-20-21(17,18)13(14,15)16/h4-5,7,9H,2-3,6,8H2,1H3 |
| InChIKey | VBMCMILPQYGINH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|