About 1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole
1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole (PubChem CID 10041936) has the molecular formula C18H16N2O2S
and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole.
Molecular Properties
| Compound Name | 1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole |
| PubChem CID | 10041936 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole |
| SMILES | Cn1c(-c2ccccc2)cc2c(S(C)(=O)=O)c3ccccc3n21 |
| InChI | InChI=1S/C18H16N2O2S/c1-19-16(13-8-4-3-5-9-13)12-17-18(23(2,21)22)14-10-6-7-11-15(14)20(17)19/h3-12H,1-2H3 |
| InChIKey | XXNYAXAZIJFLRM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole?
The IUPAC name of 1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole (CID 10041936) is 1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole.
What is the SMILES notation for 1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole?
The canonical SMILES for 1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole is Cn1c(-c2ccccc2)cc2c(S(C)(=O)=O)c3ccccc3n21.
What is the InChIKey of 1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole?
The InChIKey is XXNYAXAZIJFLRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2S/c1-19-16(13-8-4-3-5-9-13)12-17-18(23(2,21)22)14-10-6-7-11-15(14)20(17)19/h3-12H,1-2H3.
What are the key properties of 1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole?
1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole has a molecular weight of 324.41 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-methylsulfonyl-2-phenylpyrazolo[1,5-a]indole is sourced from PubChem (CID 10041936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).