C22H28O2 — CID 10041950
(2E,4E)-6-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)hepta-2,4,6-trienoic acid (PubChem CID 10041950) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is (2E,4E)-6-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)hepta-2,4,6-trienoic acid.
| Compound Name | (2E,4E)-6-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)hepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 10041950 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (2E,4E)-6-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)hepta-2,4,6-trienoic acid |
| SMILES | C=C(/C=C/C=C/C(=O)O)c1cc(C(C)(C)C)cc2c1CCC2(C)C |
| InChI | InChI=1S/C22H28O2/c1-15(9-7-8-10-20(23)24)18-13-16(21(2,3)4)14-19-17(18)11-12-22(19,5)6/h7-10,13-14H,1,11-12H2,2-6H3,(H,23,24)/b9-7+,10-8+ |
| InChIKey | UHQJHBGTDKDTSP-FIFLTTCUSA-N |
| XLogP | 5.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|