C12H24O6P2 — CID 10042032
[(4E)-5,9-dimethyl-1-phosphonodeca-4,8-dienyl]phosphonic acid (PubChem CID 10042032) has the molecular formula C12H24O6P2 and a molecular weight of 326.27 g/mol. Its IUPAC name is [(4E)-5,9-dimethyl-1-phosphonodeca-4,8-dienyl]phosphonic acid.
| Compound Name | [(4E)-5,9-dimethyl-1-phosphonodeca-4,8-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 10042032 |
| Molecular Formula | C12H24O6P2 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | [(4E)-5,9-dimethyl-1-phosphonodeca-4,8-dienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CCC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C12H24O6P2/c1-10(2)6-4-7-11(3)8-5-9-12(19(13,14)15)20(16,17)18/h6,8,12H,4-5,7,9H2,1-3H3,(H2,13,14,15)(H2,16,17,18)/b11-8+ |
| InChIKey | FGZUXOITCHCUOX-DHZHZOJOSA-N |
| XLogP | 3.14 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|