C22H30O2 — CID 10042068
3-[(Z)-hex-1-enyl]-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 10042068) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is 3-[(Z)-hex-1-enyl]-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | 3-[(Z)-hex-1-enyl]-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 10042068 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 3-[(Z)-hex-1-enyl]-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCC/C=C\c1cc(O)c2c(c1)OC(C)(C)C1CC=C(C)CC21 |
| InChI | InChI=1S/C22H30O2/c1-5-6-7-8-9-16-13-19(23)21-17-12-15(2)10-11-18(17)22(3,4)24-20(21)14-16/h8-10,13-14,17-18,23H,5-7,11-12H2,1-4H3/b9-8- |
| InChIKey | PCJVPMCGPBQCJN-HJWRWDBZSA-N |
| XLogP | 6.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|