C20H29NOSi — CID 10042117
4-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-1-butanamine (PubChem CID 10042117) has the molecular formula C20H29NOSi and a molecular weight of 327.50 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxybutan-1-amine.
| Compound Name | 4-[[(1,1-Dimethylethyl)diphenylsilyl]oxy]-1-butanamine |
|---|---|
| PubChem CID | 10042117 |
| Molecular Formula | C20H29NOSi |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxybutan-1-amine |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCCCCN |
| InChI | InChI=1S/C20H29NOSi/c1-20(2,3)23(22-17-11-10-16-21,18-12-6-4-7-13-18)19-14-8-5-9-15-19/h4-9,12-15H,10-11,16-17,21H2,1-3H3 |
| InChIKey | YHWUJDSSJRLWMX-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 35.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | 309 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|