About 1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea
1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea (PubChem CID 10042481) has the molecular formula C16H13Cl2N3O
and a molecular weight of 334.21 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea.
Molecular Properties
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea |
| PubChem CID | 10042481 |
| Molecular Formula | C16H13Cl2N3O |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea |
| SMILES | O=C(NCc1ccc(Cl)c(Cl)c1)Nc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C16H13Cl2N3O/c17-12-5-4-10(8-13(12)18)9-20-16(22)21-15-3-1-2-14-11(15)6-7-19-14/h1-8,19H,9H2,(H2,20,21,22) |
| InChIKey | WUYBGAPOFSZNQC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea?
The IUPAC name of 1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea (CID 10042481) is 1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea.
What is the SMILES notation for 1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea?
The canonical SMILES for 1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea is O=C(NCc1ccc(Cl)c(Cl)c1)Nc1cccc2[nH]ccc12.
What is the InChIKey of 1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea?
The InChIKey is WUYBGAPOFSZNQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl2N3O/c17-12-5-4-10(8-13(12)18)9-20-16(22)21-15-3-1-2-14-11(15)6-7-19-14/h1-8,19H,9H2,(H2,20,21,22).
What are the key properties of 1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea?
1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea has a molecular weight of 334.21 g/mol, XLogP of 4.80, 3 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dichlorophenyl)methyl]-3-(1H-indol-4-yl)urea is sourced from PubChem (CID 10042481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).