C24H24N2 — CID 10042900
4-[6-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]naphthalen-2-yl]benzonitrile (PubChem CID 10042900) has the molecular formula C24H24N2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-[6-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]naphthalen-2-yl]benzonitrile.
| Compound Name | 4-[6-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]naphthalen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 10042900 |
| Molecular Formula | C24H24N2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 4-[6-[2-[(2R)-2-methylpyrrolidin-1-yl]ethyl]naphthalen-2-yl]benzonitrile |
| SMILES | C[C@@H]1CCCN1CCc1ccc2cc(-c3ccc(C#N)cc3)ccc2c1 |
| InChI | InChI=1S/C24H24N2/c1-18-3-2-13-26(18)14-12-19-4-9-24-16-23(11-10-22(24)15-19)21-7-5-20(17-25)6-8-21/h4-11,15-16,18H,2-3,12-14H2,1H3/t18-/m1/s1 |
| InChIKey | AULXVGJBLMFJCV-GOSISDBHSA-N |
| XLogP | 5.41 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |