C25H28N2O4S — CID 1004340
(2S)-N,N-dibenzyl-2-(4-methoxy-N-methylsulfonylanilino)propanamide (PubChem CID 1004340) has the molecular formula C25H28N2O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-2-(4-methoxy-N-methylsulfonylanilino)propanamide.
| Compound Name | (2S)-N,N-dibenzyl-2-(4-methoxy-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 1004340 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (2S)-N,N-dibenzyl-2-(4-methoxy-N-methylsulfonylanilino)propanamide |
| SMILES | COc1ccc(N([C@@H](C)C(=O)N(Cc2ccccc2)Cc2ccccc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H28N2O4S/c1-20(27(32(3,29)30)23-14-16-24(31-2)17-15-23)25(28)26(18-21-10-6-4-7-11-21)19-22-12-8-5-9-13-22/h4-17,20H,18-19H2,1-3H3/t20-/m0/s1 |
| InChIKey | YMNZDBMPEZEREB-FQEVSTJZSA-N |
| XLogP | 4.08 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |