C14H21F7O2 — CID 10043678
3-cyclohexyl-3-ethoxy-4,4,5,5,6,6,6-heptafluorohexan-2-ol (PubChem CID 10043678) has the molecular formula C14H21F7O2 and a molecular weight of 354.31 g/mol. Its IUPAC name is 3-cyclohexyl-3-ethoxy-4,4,5,5,6,6,6-heptafluorohexan-2-ol.
| Compound Name | 3-cyclohexyl-3-ethoxy-4,4,5,5,6,6,6-heptafluorohexan-2-ol |
|---|---|
| PubChem CID | 10043678 |
| Molecular Formula | C14H21F7O2 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 3-cyclohexyl-3-ethoxy-4,4,5,5,6,6,6-heptafluorohexan-2-ol |
| SMILES | CCOC(C(C)O)(C1CCCCC1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H21F7O2/c1-3-23-11(9(2)22,10-7-5-4-6-8-10)12(15,16)13(17,18)14(19,20)21/h9-10,22H,3-8H2,1-2H3 |
| InChIKey | BQFIYMSQJKREBQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|