About 4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one
4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one (PubChem CID 10043694) has the molecular formula C21H22O5
and a molecular weight of 354.40 g/mol. Its IUPAC name is 4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one.
Molecular Properties
| Compound Name | 4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one |
| PubChem CID | 10043694 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one |
| SMILES | CC(C)=CCOc1c2ccoc2c(OCC=C(C)C)c2oc(=O)ccc12 |
| InChI | InChI=1S/C21H22O5/c1-13(2)7-10-23-18-15-5-6-17(22)26-20(15)21(25-11-8-14(3)4)19-16(18)9-12-24-19/h5-9,12H,10-11H2,1-4H3 |
| InChIKey | HJMDOAWWVCOEDW-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 61.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one?
The IUPAC name of 4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one (CID 10043694) is 4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one.
What is the SMILES notation for 4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one?
The canonical SMILES for 4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one is CC(C)=CCOc1c2ccoc2c(OCC=C(C)C)c2oc(=O)ccc12.
What is the InChIKey of 4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one?
The InChIKey is HJMDOAWWVCOEDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22O5/c1-13(2)7-10-23-18-15-5-6-17(22)26-20(15)21(25-11-8-14(3)4)19-16(18)9-12-24-19/h5-9,12H,10-11H2,1-4H3.
What are the key properties of 4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one?
4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one has a molecular weight of 354.40 g/mol, XLogP of 5.23, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,9-bis(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one is sourced from PubChem (CID 10043694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).