About 3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate
3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate (PubChem CID 10043712) has the molecular formula C22H26O4
and a molecular weight of 354.45 g/mol. Its IUPAC name is 3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate.
Molecular Properties
| Compound Name | 3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate |
| PubChem CID | 10043712 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate |
| SMILES | COc1c(C(=O)OCCC(C)C)c2c(c3ccccc13)OC(C)(C)C=C2 |
| InChI | InChI=1S/C22H26O4/c1-14(2)11-13-25-21(23)18-17-10-12-22(3,4)26-19(17)15-8-6-7-9-16(15)20(18)24-5/h6-10,12,14H,11,13H2,1-5H3 |
| InChIKey | QVFHATOJDLHYFF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate?
The IUPAC name of 3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate (CID 10043712) is 3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate.
What is the SMILES notation for 3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate?
The canonical SMILES for 3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate is COc1c(C(=O)OCCC(C)C)c2c(c3ccccc13)OC(C)(C)C=C2.
What is the InChIKey of 3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate?
The InChIKey is QVFHATOJDLHYFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26O4/c1-14(2)11-13-25-21(23)18-17-10-12-22(3,4)26-19(17)15-8-6-7-9-16(15)20(18)24-5/h6-10,12,14H,11,13H2,1-5H3.
What are the key properties of 3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate?
3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate has a molecular weight of 354.45 g/mol, XLogP of 5.24, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl 6-methoxy-2,2-dimethylbenzo[h]chromene-5-carboxylate is sourced from PubChem (CID 10043712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).