C22H26O2S — CID 10043729
5-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]thiophene-2-carboxylic acid (PubChem CID 10043729) has the molecular formula C22H26O2S and a molecular weight of 354.52 g/mol. Its IUPAC name is 5-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 10043729 |
| Molecular Formula | C22H26O2S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 5-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]thiophene-2-carboxylic acid |
| SMILES | C=C(c1ccc(C(=O)O)s1)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C22H26O2S/c1-13-11-16-17(22(5,6)10-9-21(16,3)4)12-15(13)14(2)18-7-8-19(25-18)20(23)24/h7-8,11-12H,2,9-10H2,1,3-6H3,(H,23,24) |
| InChIKey | RXVCVOBCGBBMCP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |