C16H18O3S3 — CID 10043732
4-(4-phenoxyphenyl)sulfonylbutane-1,2-dithiol (PubChem CID 10043732) has the molecular formula C16H18O3S3 and a molecular weight of 354.52 g/mol. Its IUPAC name is 4-(4-phenoxyphenyl)sulfonylbutane-1,2-dithiol.
| Compound Name | 4-(4-phenoxyphenyl)sulfonylbutane-1,2-dithiol |
|---|---|
| PubChem CID | 10043732 |
| Molecular Formula | C16H18O3S3 |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 4-(4-phenoxyphenyl)sulfonylbutane-1,2-dithiol |
| SMILES | O=S(=O)(CCC(S)CS)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C16H18O3S3/c17-22(18,11-10-15(21)12-20)16-8-6-14(7-9-16)19-13-4-2-1-3-5-13/h1-9,15,20-21H,10-12H2 |
| InChIKey | VALKNOMNTXYCBM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|