C21H25NO4 — CID 10043762
11-[3-(dimethylamino)propoxy]-4-methyl-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-2-one (PubChem CID 10043762) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 11-[3-(dimethylamino)propoxy]-4-methyl-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-2-one.
| Compound Name | 11-[3-(dimethylamino)propoxy]-4-methyl-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-2-one |
|---|---|
| PubChem CID | 10043762 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 11-[3-(dimethylamino)propoxy]-4-methyl-6,7,8,9-tetrahydro-[1]benzofuro[3,2-g]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c(OCCCN(C)C)c3oc4c(c3cc12)CCCC4 |
| InChI | InChI=1S/C21H25NO4/c1-13-11-18(23)26-19-15(13)12-16-14-7-4-5-8-17(14)25-20(16)21(19)24-10-6-9-22(2)3/h11-12H,4-10H2,1-3H3 |
| InChIKey | HDPOQTZAVXOKEM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|