C17H14ClN5O2 — CID 10043795
methyl 2-[[(Z)-2-[1-(4-chlorophenyl)tetrazol-5-yl]ethenyl]amino]benzoate (PubChem CID 10043795) has the molecular formula C17H14ClN5O2 and a molecular weight of 355.79 g/mol. Its IUPAC name is methyl 2-[[(Z)-2-[1-(4-chlorophenyl)tetrazol-5-yl]ethenyl]amino]benzoate.
| Compound Name | methyl 2-[[(Z)-2-[1-(4-chlorophenyl)tetrazol-5-yl]ethenyl]amino]benzoate |
|---|---|
| PubChem CID | 10043795 |
| Molecular Formula | C17H14ClN5O2 |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | methyl 2-[[(Z)-2-[1-(4-chlorophenyl)tetrazol-5-yl]ethenyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1N/C=C\c1nnnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14ClN5O2/c1-25-17(24)14-4-2-3-5-15(14)19-11-10-16-20-21-22-23(16)13-8-6-12(18)7-9-13/h2-11,19H,1H3/b11-10- |
| InChIKey | QTDDJKBCYLDYKD-KHPPLWFESA-N |
| XLogP | 3.19 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |