C18H13F3N4O — CID 10043925
5-(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-4-(3,4,5-trifluorophenyl)-1,3-oxazole (PubChem CID 10043925) has the molecular formula C18H13F3N4O and a molecular weight of 358.32 g/mol. Its IUPAC name is 5-(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-4-(3,4,5-trifluorophenyl)-1,3-oxazole.
| Compound Name | 5-(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-4-(3,4,5-trifluorophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 10043925 |
| Molecular Formula | C18H13F3N4O |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 5-(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-4-(3,4,5-trifluorophenyl)-1,3-oxazole |
| SMILES | CC(C)c1nnc2ccc(-c3ocnc3-c3cc(F)c(F)c(F)c3)cn12 |
| InChI | InChI=1S/C18H13F3N4O/c1-9(2)18-24-23-14-4-3-10(7-25(14)18)17-16(22-8-26-17)11-5-12(19)15(21)13(20)6-11/h3-9H,1-2H3 |
| InChIKey | LSVSRXQCNHLTNR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|