C22H32O4 — CID 10044086
(4E)-4-[(1R,2R,3S,6R,8S)-2-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-3-hydroxy-8-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid (PubChem CID 10044086) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (4E)-4-[(1R,2R,3S,6R,8S)-2-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-3-hydroxy-8-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid.
| Compound Name | (4E)-4-[(1R,2R,3S,6R,8S)-2-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-3-hydroxy-8-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid |
|---|---|
| PubChem CID | 10044086 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (4E)-4-[(1R,2R,3S,6R,8S)-2-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-3-hydroxy-8-methyl-7-bicyclo[4.2.0]octanylidene]butanoic acid |
| SMILES | C[C@@H]1/C(=C\CCC(=O)O)[C@@H]2CC[C@H](O)[C@@H](C#C[C@@H](O)C3CCCCC3)[C@H]12 |
| InChI | InChI=1S/C22H32O4/c1-14-16(8-5-9-21(25)26)17-10-13-20(24)18(22(14)17)11-12-19(23)15-6-3-2-4-7-15/h8,14-15,17-20,22-24H,2-7,9-10,13H2,1H3,(H,25,26)/b16-8+/t14-,17+,18-,19-,20+,22-/m1/s1 |
| InChIKey | IPHZMKYFKPDFPL-UURYSJKDSA-N |
| XLogP | 3.38 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|