C24H28O3 — CID 10044332
(2R,3R,4aR,10aS)-4a-ethyl-3,9-dimethyl-2-phenyl-4,10a-dihydro-1H-phenanthrene-2,3,7-triol (PubChem CID 10044332) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is (2R,3R,4aR,10aS)-4a-ethyl-3,9-dimethyl-2-phenyl-4,10a-dihydro-1H-phenanthrene-2,3,7-triol.
| Compound Name | (2R,3R,4aR,10aS)-4a-ethyl-3,9-dimethyl-2-phenyl-4,10a-dihydro-1H-phenanthrene-2,3,7-triol |
|---|---|
| PubChem CID | 10044332 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (2R,3R,4aR,10aS)-4a-ethyl-3,9-dimethyl-2-phenyl-4,10a-dihydro-1H-phenanthrene-2,3,7-triol |
| SMILES | CC[C@@]12C[C@@](C)(O)[C@](O)(c3ccccc3)C[C@H]1C=C(C)c1cc(O)ccc12 |
| InChI | InChI=1S/C24H28O3/c1-4-23-15-22(3,26)24(27,17-8-6-5-7-9-17)14-18(23)12-16(2)20-13-19(25)10-11-21(20)23/h5-13,18,25-27H,4,14-15H2,1-3H3/t18-,22-,23-,24-/m1/s1 |
| InChIKey | SYEXEROQLLTYNG-RKNIQEAPSA-N |
| XLogP | 4.51 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |