C17H25N3O6 — CID 10044477
pentyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-ethenyl-2-oxopyrimidin-4-yl]carbamate (PubChem CID 10044477) has the molecular formula C17H25N3O6 and a molecular weight of 367.40 g/mol. Its IUPAC name is pentyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-ethenyl-2-oxopyrimidin-4-yl]carbamate.
| Compound Name | pentyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-ethenyl-2-oxopyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 10044477 |
| Molecular Formula | C17H25N3O6 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | pentyl N-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-methyloxolan-2-yl]-5-ethenyl-2-oxopyrimidin-4-yl]carbamate |
| SMILES | C=Cc1cn([C@@H]2O[C@H](C)[C@@H](O)[C@H]2O)c(=O)nc1NC(=O)OCCCCC |
| InChI | InChI=1S/C17H25N3O6/c1-4-6-7-8-25-17(24)19-14-11(5-2)9-20(16(23)18-14)15-13(22)12(21)10(3)26-15/h5,9-10,12-13,15,21-22H,2,4,6-8H2,1,3H3,(H,18,19,23,24)/t10-,12-,13-,15-/m1/s1 |
| InChIKey | SSIDJRKKVMGWJX-BPGGGUHBSA-N |
| XLogP | 1.26 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|