About N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide
N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide (PubChem CID 10044540) has the molecular formula C20H20N2O3S
and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide |
| PubChem CID | 10044540 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide |
| SMILES | COc1ccc(-c2nc(CNC(C)=O)sc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O3S/c1-13(23)21-12-18-22-19(14-4-8-16(24-2)9-5-14)20(26-18)15-6-10-17(25-3)11-7-15/h4-11H,12H2,1-3H3,(H,21,23) |
| InChIKey | BHZYOKCFUBCZPW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide?
The IUPAC name of N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide (CID 10044540) is N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide.
What is the SMILES notation for N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide?
The canonical SMILES for N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide is COc1ccc(-c2nc(CNC(C)=O)sc2-c2ccc(OC)cc2)cc1.
What is the InChIKey of N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide?
The InChIKey is BHZYOKCFUBCZPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O3S/c1-13(23)21-12-18-22-19(14-4-8-16(24-2)9-5-14)20(26-18)15-6-10-17(25-3)11-7-15/h4-11H,12H2,1-3H3,(H,21,23).
What are the key properties of N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide?
N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide has a molecular weight of 368.46 g/mol, XLogP of 4.13, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]acetamide is sourced from PubChem (CID 10044540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).