About 5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine
5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine (PubChem CID 10044577) has the molecular formula C20H14F3N3O
and a molecular weight of 369.35 g/mol. Its IUPAC name is 5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine |
| PubChem CID | 10044577 |
| Molecular Formula | C20H14F3N3O |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine |
| SMILES | Fc1ccc(CC(Nc2nc3cc(F)c(F)cc3o2)c2ccccn2)cc1 |
| InChI | InChI=1S/C20H14F3N3O/c21-13-6-4-12(5-7-13)9-17(16-3-1-2-8-24-16)25-20-26-18-10-14(22)15(23)11-19(18)27-20/h1-8,10-11,17H,9H2,(H,25,26) |
| InChIKey | LHUJWZKZQRJFRN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine?
The IUPAC name of 5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine (CID 10044577) is 5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine.
What is the SMILES notation for 5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine?
The canonical SMILES for 5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine is Fc1ccc(CC(Nc2nc3cc(F)c(F)cc3o2)c2ccccn2)cc1.
What is the InChIKey of 5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine?
The InChIKey is LHUJWZKZQRJFRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14F3N3O/c21-13-6-4-12(5-7-13)9-17(16-3-1-2-8-24-16)25-20-26-18-10-14(22)15(23)11-19(18)27-20/h1-8,10-11,17H,9H2,(H,25,26).
What are the key properties of 5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine?
5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine has a molecular weight of 369.35 g/mol, XLogP of 5.04, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluoro-N-[2-(4-fluorophenyl)-1-pyridin-2-ylethyl]-1,3-benzoxazol-2-amine is sourced from PubChem (CID 10044577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).