C19H16BrNO2 — CID 10044629
1-bromo-N-[(1S)-2-hydroxy-1-phenylethyl]naphthalene-2-carboxamide (PubChem CID 10044629) has the molecular formula C19H16BrNO2 and a molecular weight of 370.25 g/mol. Its IUPAC name is 1-bromo-N-[(1S)-2-hydroxy-1-phenylethyl]naphthalene-2-carboxamide.
| Compound Name | 1-bromo-N-[(1S)-2-hydroxy-1-phenylethyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 10044629 |
| Molecular Formula | C19H16BrNO2 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 1-bromo-N-[(1S)-2-hydroxy-1-phenylethyl]naphthalene-2-carboxamide |
| SMILES | O=C(N[C@H](CO)c1ccccc1)c1ccc2ccccc2c1Br |
| InChI | InChI=1S/C19H16BrNO2/c20-18-15-9-5-4-6-13(15)10-11-16(18)19(23)21-17(12-22)14-7-2-1-3-8-14/h1-11,17,22H,12H2,(H,21,23)/t17-/m1/s1 |
| InChIKey | XFEYDSSPTJZFPL-QGZVFWFLSA-N |
| XLogP | 4.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |