C20H26N2O5 — CID 10044940
(3'aS,4R,5'R,6'S,6'aS)-5'-(benzyliminomethylideneamino)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,4'-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole]-6'-ol (PubChem CID 10044940) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is (3'aS,4R,5'R,6'S,6'aS)-5'-(benzyliminomethylideneamino)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,4'-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole]-6'-ol.
| Compound Name | (3'aS,4R,5'R,6'S,6'aS)-5'-(benzyliminomethylideneamino)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,4'-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole]-6'-ol |
|---|---|
| PubChem CID | 10044940 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (3'aS,4R,5'R,6'S,6'aS)-5'-(benzyliminomethylideneamino)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,4'-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole]-6'-ol |
| SMILES | CC1(C)O[C@H]2[C@@H](O)[C@@H](N=C=NCc3ccccc3)[C@@]3(COC(C)(C)O3)[C@H]2O1 |
| InChI | InChI=1S/C20H26N2O5/c1-18(2)24-11-20(27-18)16(14(23)15-17(20)26-19(3,4)25-15)22-12-21-10-13-8-6-5-7-9-13/h5-9,14-17,23H,10-11H2,1-4H3/t14-,15+,16-,17+,20+/m1/s1 |
| InChIKey | SPDAOCGKAUSQAF-SUFIHLRJSA-N |
| XLogP | 2.15 |
| TPSA | 81.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|