C23H34O4 — CID 10044961
(5E)-5-[(1R,2R,3S,6R,8S)-2-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-3-hydroxy-8-methyl-7-bicyclo[4.2.0]octanylidene]pentanoic acid (PubChem CID 10044961) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (5E)-5-[(1R,2R,3S,6R,8S)-2-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-3-hydroxy-8-methyl-7-bicyclo[4.2.0]octanylidene]pentanoic acid.
| Compound Name | (5E)-5-[(1R,2R,3S,6R,8S)-2-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-3-hydroxy-8-methyl-7-bicyclo[4.2.0]octanylidene]pentanoic acid |
|---|---|
| PubChem CID | 10044961 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (5E)-5-[(1R,2R,3S,6R,8S)-2-[(3S)-3-cyclohexyl-3-hydroxyprop-1-ynyl]-3-hydroxy-8-methyl-7-bicyclo[4.2.0]octanylidene]pentanoic acid |
| SMILES | C[C@@H]1/C(=C\CCCC(=O)O)[C@@H]2CC[C@H](O)[C@@H](C#C[C@@H](O)C3CCCCC3)[C@H]12 |
| InChI | InChI=1S/C23H34O4/c1-15-17(9-5-6-10-22(26)27)18-11-14-21(25)19(23(15)18)12-13-20(24)16-7-3-2-4-8-16/h9,15-16,18-21,23-25H,2-8,10-11,14H2,1H3,(H,26,27)/b17-9+/t15-,18+,19-,20-,21+,23-/m1/s1 |
| InChIKey | MLAWTHBKEGLCBR-KKZQTLKKSA-N |
| XLogP | 3.77 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|