C19H18O7 — CID 10045040
(Z)-3-methoxy-3-(2,5,10-trihydroxy-2-(113C)methyl-4-oxo-1,3-dihydroanthracen-1-yl)(1,2,3-13C3)prop-2-enoic acid (PubChem CID 10045040) has the molecular formula C19H18O7 and a molecular weight of 376.21 g/mol. Its IUPAC name is (Z)-3-methoxy-3-(2,5,10-trihydroxy-2-(113C)methyl-4-oxo-1,3-dihydroanthracen-1-yl)(1,2,3-13C3)prop-2-enoic acid.
| Compound Name | (Z)-3-methoxy-3-(2,5,10-trihydroxy-2-(113C)methyl-4-oxo-1,3-dihydroanthracen-1-yl)(1,2,3-13C3)prop-2-enoic acid |
|---|---|
| PubChem CID | 10045040 |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (Z)-3-methoxy-3-(2,5,10-trihydroxy-2-(113C)methyl-4-oxo-1,3-dihydroanthracen-1-yl)(1,2,3-13C3)prop-2-enoic acid |
| SMILES | CO/[13C](=[13CH]\[13C](=O)O)[13CH]1[13c]2[13cH][13c]3[13cH][13cH][13cH][13c](O)[13c]3[13c](O)[13c]2[13C](=O)[13CH2][13C]1([13CH3])O |
| InChI | InChI=1S/C19H18O7/c1-19(25)8-12(21)16-10(17(19)13(26-2)7-14(22)23)6-9-4-3-5-11(20)15(9)18(16)24/h3-7,17,20,24-25H,8H2,1-2H3,(H,22,23)/b13-7-/i1+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1,13+1,14+1,15+1,16+1,17+1,18+1,19+1 |
| InChIKey | OBCPKCVHPDMGIX-HGHFDXKYSA-N |
| XLogP | 2.29 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|