About [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol
[4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol (PubChem CID 10045088) has the molecular formula C23H28N4O
and a molecular weight of 376.50 g/mol. Its IUPAC name is [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol.
Molecular Properties
| Compound Name | [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol |
| PubChem CID | 10045088 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol |
| SMILES | Cc1nc2ccccc2c(Nc2ccc(N3CCN(C)C(C)C3)cc2)c1CO |
| InChI | InChI=1S/C23H28N4O/c1-16-14-27(13-12-26(16)3)19-10-8-18(9-11-19)25-23-20-6-4-5-7-22(20)24-17(2)21(23)15-28/h4-11,16,28H,12-15H2,1-3H3,(H,24,25) |
| InChIKey | BSEZBDDBKUJHQP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol?
The IUPAC name of [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol (CID 10045088) is [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol.
What is the SMILES notation for [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol?
The canonical SMILES for [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol is Cc1nc2ccccc2c(Nc2ccc(N3CCN(C)C(C)C3)cc2)c1CO.
What is the InChIKey of [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol?
The InChIKey is BSEZBDDBKUJHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N4O/c1-16-14-27(13-12-26(16)3)19-10-8-18(9-11-19)25-23-20-6-4-5-7-22(20)24-17(2)21(23)15-28/h4-11,16,28H,12-15H2,1-3H3,(H,24,25).
What are the key properties of [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol?
[4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol has a molecular weight of 376.50 g/mol, XLogP of 3.92, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(3,4-dimethylpiperazin-1-yl)anilino]-2-methylquinolin-3-yl]methanol is sourced from PubChem (CID 10045088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).