About (4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate
(4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate (PubChem CID 10045357) has the molecular formula C21H17ClN2O3
and a molecular weight of 380.83 g/mol. Its IUPAC name is (4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate.
Molecular Properties
| Compound Name | (4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate |
| PubChem CID | 10045357 |
| Molecular Formula | C21H17ClN2O3 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate |
| SMILES | CCNC(=O)OC1=C(c2ccccc2)Oc2c(Cl)cccc2-n2cccc21 |
| InChI | InChI=1S/C21H17ClN2O3/c1-2-23-21(25)27-20-17-12-7-13-24(17)16-11-6-10-15(22)19(16)26-18(20)14-8-4-3-5-9-14/h3-13H,2H2,1H3,(H,23,25) |
| InChIKey | GWZJPHCRCLWITM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate?
The IUPAC name of (4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate (CID 10045357) is (4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate.
What is the SMILES notation for (4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate?
The canonical SMILES for (4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate is CCNC(=O)OC1=C(c2ccccc2)Oc2c(Cl)cccc2-n2cccc21.
What is the InChIKey of (4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate?
The InChIKey is GWZJPHCRCLWITM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClN2O3/c1-2-23-21(25)27-20-17-12-7-13-24(17)16-11-6-10-15(22)19(16)26-18(20)14-8-4-3-5-9-14/h3-13H,2H2,1H3,(H,23,25).
What are the key properties of (4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate?
(4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate has a molecular weight of 380.83 g/mol, XLogP of 5.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl) N-ethylcarbamate is sourced from PubChem (CID 10045357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).