C23H27NO4 — CID 10045395
(4-ethoxycarbonylphenyl) 1,4,4,7-tetramethyl-2,3-dihydroquinoline-6-carboxylate (PubChem CID 10045395) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (4-ethoxycarbonylphenyl) 1,4,4,7-tetramethyl-2,3-dihydroquinoline-6-carboxylate.
| Compound Name | (4-ethoxycarbonylphenyl) 1,4,4,7-tetramethyl-2,3-dihydroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 10045395 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (4-ethoxycarbonylphenyl) 1,4,4,7-tetramethyl-2,3-dihydroquinoline-6-carboxylate |
| SMILES | CCOC(=O)c1ccc(OC(=O)c2cc3c(cc2C)N(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-6-27-21(25)16-7-9-17(10-8-16)28-22(26)18-14-19-20(13-15(18)2)24(5)12-11-23(19,3)4/h7-10,13-14H,6,11-12H2,1-5H3 |
| InChIKey | NHPSIGTUSHGWRX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|