C21H21NO4S — CID 10045503
dimethyl 9,9-dimethyl-8-thia-12-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,11,13,15-heptaene-10,11-dicarboxylate (PubChem CID 10045503) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is dimethyl 9,9-dimethyl-8-thia-12-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,11,13,15-heptaene-10,11-dicarboxylate.
| Compound Name | dimethyl 9,9-dimethyl-8-thia-12-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,11,13,15-heptaene-10,11-dicarboxylate |
|---|---|
| PubChem CID | 10045503 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | dimethyl 9,9-dimethyl-8-thia-12-azatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,11,13,15-heptaene-10,11-dicarboxylate |
| SMILES | COC(=O)/C1=N/c2ccccc2-c2ccccc2SC(C)(C)C1C(=O)OC |
| InChI | InChI=1S/C21H21NO4S/c1-21(2)17(19(23)25-3)18(20(24)26-4)22-15-11-7-5-9-13(15)14-10-6-8-12-16(14)27-21/h5-12,17H,1-4H3/b22-18+ |
| InChIKey | YUZDHIDEHMKNIF-RELWKKBWSA-N |
| XLogP | 4.27 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |