C16H9Cl2F2N3O2 — CID 10045531
2,2-dichloro-N-[5-[3-(2,6-difluorophenyl)-1,2-oxazol-5-yl]-3-pyridinyl]acetamide (PubChem CID 10045531) has the molecular formula C16H9Cl2F2N3O2 and a molecular weight of 384.17 g/mol. Its IUPAC name is 2,2-dichloro-N-[5-[3-(2,6-difluorophenyl)-1,2-oxazol-5-yl]-3-pyridinyl]acetamide.
| Compound Name | 2,2-dichloro-N-[5-[3-(2,6-difluorophenyl)-1,2-oxazol-5-yl]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 10045531 |
| Molecular Formula | C16H9Cl2F2N3O2 |
| Molecular Weight | 384.17 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | 2,2-dichloro-N-[5-[3-(2,6-difluorophenyl)-1,2-oxazol-5-yl]-3-pyridinyl]acetamide |
| SMILES | O=C(Nc1cncc(-c2cc(-c3c(F)cccc3F)no2)c1)C(Cl)Cl |
| InChI | InChI=1S/C16H9Cl2F2N3O2/c17-15(18)16(24)22-9-4-8(6-21-7-9)13-5-12(23-25-13)14-10(19)2-1-3-11(14)20/h1-7,15H,(H,22,24) |
| InChIKey | MHEQNULOYOKLET-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.17 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|