C20H26N4O4 — CID 10045699
3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-6,6-dimethylhept-4-ynoic acid (PubChem CID 10045699) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-6,6-dimethylhept-4-ynoic acid.
| Compound Name | 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-6,6-dimethylhept-4-ynoic acid |
|---|---|
| PubChem CID | 10045699 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 3-[[4-(4-carbamimidoylanilino)-4-oxobutanoyl]amino]-6,6-dimethylhept-4-ynoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CCC(=O)NC(C#CC(C)(C)C)CC(=O)O)cc1 |
| InChI | InChI=1S/C20H26N4O4/c1-20(2,3)11-10-15(12-18(27)28)24-17(26)9-8-16(25)23-14-6-4-13(5-7-14)19(21)22/h4-7,15H,8-9,12H2,1-3H3,(H3,21,22)(H,23,25)(H,24,26)(H,27,28) |
| InChIKey | CVKYGTKNXPJQJB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 145.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|