C25H38O3 — CID 10045716
2-[[(1R,4aR,4bS,10aS)-4b,8,8,10a-tetramethyl-2-methylidene-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-1-yl]methyl]-3-(hydroxymethyl)-2H-furan-5-one (PubChem CID 10045716) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is 2-[[(1R,4aR,4bS,10aS)-4b,8,8,10a-tetramethyl-2-methylidene-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-1-yl]methyl]-3-(hydroxymethyl)-2H-furan-5-one.
| Compound Name | 2-[[(1R,4aR,4bS,10aS)-4b,8,8,10a-tetramethyl-2-methylidene-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-1-yl]methyl]-3-(hydroxymethyl)-2H-furan-5-one |
|---|---|
| PubChem CID | 10045716 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 2-[[(1R,4aR,4bS,10aS)-4b,8,8,10a-tetramethyl-2-methylidene-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-1-yl]methyl]-3-(hydroxymethyl)-2H-furan-5-one |
| SMILES | C=C1CC[C@H]2[C@@](C)(CCC3C(C)(C)CCC[C@@]32C)[C@@H]1CC1OC(=O)C=C1CO |
| InChI | InChI=1S/C25H38O3/c1-16-7-8-21-24(4,18(16)14-19-17(15-26)13-22(27)28-19)12-9-20-23(2,3)10-6-11-25(20,21)5/h13,18-21,26H,1,6-12,14-15H2,2-5H3/t18-,19?,20?,21+,24+,25+/m1/s1 |
| InChIKey | IDZSBARYKPRHAX-JKSOPSCNSA-N |
| XLogP | 5.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|