About N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide
N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide (PubChem CID 10045765) has the molecular formula C24H37NO3
and a molecular weight of 387.56 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide.
Molecular Properties
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide |
| PubChem CID | 10045765 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide |
| SMILES | CCCCCCC1CCC(C(=O)Nc2c(C(C)C)cccc2C(C)C)C(=O)O1 |
| InChI | InChI=1S/C24H37NO3/c1-6-7-8-9-11-18-14-15-21(24(27)28-18)23(26)25-22-19(16(2)3)12-10-13-20(22)17(4)5/h10,12-13,16-18,21H,6-9,11,14-15H2,1-5H3,(H,25,26) |
| InChIKey | VJZFFUMYGQUPGF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide?
The IUPAC name of N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide (CID 10045765) is N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide.
What is the SMILES notation for N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide?
The canonical SMILES for N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide is CCCCCCC1CCC(C(=O)Nc2c(C(C)C)cccc2C(C)C)C(=O)O1.
What is the InChIKey of N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide?
The InChIKey is VJZFFUMYGQUPGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H37NO3/c1-6-7-8-9-11-18-14-15-21(24(27)28-18)23(26)25-22-19(16(2)3)12-10-13-20(22)17(4)5/h10,12-13,16-18,21H,6-9,11,14-15H2,1-5H3,(H,25,26).
What are the key properties of N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide?
N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide has a molecular weight of 387.56 g/mol, XLogP of 6.16, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,6-di(propan-2-yl)phenyl]-6-hexyl-2-oxooxane-3-carboxamide is sourced from PubChem (CID 10045765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).