About methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate
methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate (PubChem CID 10046032) has the molecular formula C21H16N2O4S
and a molecular weight of 392.44 g/mol. Its IUPAC name is methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate.
Molecular Properties
| Compound Name | methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate |
| PubChem CID | 10046032 |
| Molecular Formula | C21H16N2O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate |
| SMILES | COC(=O)c1ccccc1C(=O)/C=C/c1ccc(C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C21H16N2O4S/c1-27-20(26)17-5-3-2-4-16(17)18(24)11-8-14-6-9-15(10-7-14)19(25)23-21-22-12-13-28-21/h2-13H,1H3,(H,22,23,25)/b11-8+ |
| InChIKey | LIQUNPPSUNHKTK-DHZHZOJOSA-N |
| XLogP | 4.08 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate?
The IUPAC name of methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate (CID 10046032) is methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate.
What is the SMILES notation for methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate?
The canonical SMILES for methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate is COC(=O)c1ccccc1C(=O)/C=C/c1ccc(C(=O)Nc2nccs2)cc1.
What is the InChIKey of methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate?
The InChIKey is LIQUNPPSUNHKTK-DHZHZOJOSA-N. The full InChI is InChI=1S/C21H16N2O4S/c1-27-20(26)17-5-3-2-4-16(17)18(24)11-8-14-6-9-15(10-7-14)19(25)23-21-22-12-13-28-21/h2-13H,1H3,(H,22,23,25)/b11-8+.
What are the key properties of methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate?
methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate has a molecular weight of 392.44 g/mol, XLogP of 4.08, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(E)-3-[4-(1,3-thiazol-2-ylcarbamoyl)phenyl]prop-2-enoyl]benzoate is sourced from PubChem (CID 10046032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).