C22H24N4O3 — CID 10046038
3-amino-5-[2-(dimethylamino)ethyl]-8,9-dimethoxyisoquinolino[4,3-c]quinolin-6-one (PubChem CID 10046038) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-amino-5-[2-(dimethylamino)ethyl]-8,9-dimethoxyisoquinolino[4,3-c]quinolin-6-one.
| Compound Name | 3-amino-5-[2-(dimethylamino)ethyl]-8,9-dimethoxyisoquinolino[4,3-c]quinolin-6-one |
|---|---|
| PubChem CID | 10046038 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-amino-5-[2-(dimethylamino)ethyl]-8,9-dimethoxyisoquinolino[4,3-c]quinolin-6-one |
| SMILES | COc1cc2c(=O)n(CCN(C)C)c3c4cc(N)ccc4ncc3c2cc1OC |
| InChI | InChI=1S/C22H24N4O3/c1-25(2)7-8-26-21-16-9-13(23)5-6-18(16)24-12-17(21)14-10-19(28-3)20(29-4)11-15(14)22(26)27/h5-6,9-12H,7-8,23H2,1-4H3 |
| InChIKey | HPMJGRNXLORLHD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|