C19H24N+ — CID 10046074
trimethyl-[(2S,4R)-4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl]azanium (PubChem CID 10046074) has the molecular formula C19H24N+ and a molecular weight of 266.41 g/mol. Its IUPAC name is trimethyl-[(2S,4R)-4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl]azanium.
| Compound Name | trimethyl-[(2S,4R)-4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl]azanium |
|---|---|
| PubChem CID | 10046074 |
| Molecular Formula | C19H24N+ |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | trimethyl-[(2S,4R)-4-phenyl-1,2,3,4-tetrahydronaphthalen-2-yl]azanium |
| SMILES | C[N+](C)(C)[C@@H]1Cc2ccccc2[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C19H24N/c1-20(2,3)17-13-16-11-7-8-12-18(16)19(14-17)15-9-5-4-6-10-15/h4-12,17,19H,13-14H2,1-3H3/q+1/t17-,19-/m1/s1 |
| InChIKey | DDJVCQZXVDKEPP-IEBWSBKVSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|