C20H33NOS2Si — CID 10046243
(1'S,8'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-carbonitrile (PubChem CID 10046243) has the molecular formula C20H33NOS2Si and a molecular weight of 395.71 g/mol. Its IUPAC name is (1'S,8'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-carbonitrile.
| Compound Name | (1'S,8'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-carbonitrile |
|---|---|
| PubChem CID | 10046243 |
| Molecular Formula | C20H33NOS2Si |
| Molecular Weight | 395.71 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (1'S,8'aS)-1'-[tert-butyl(dimethyl)silyl]oxy-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@]1(C#N)CCCC2=CC3(CC[C@@]21C)SCCS3 |
| InChI | InChI=1S/C20H33NOS2Si/c1-17(2,3)25(5,6)22-19(15-21)9-7-8-16-14-20(23-12-13-24-20)11-10-18(16,19)4/h14H,7-13H2,1-6H3/t18-,19+/m0/s1 |
| InChIKey | BASULORHBIBQFL-RBUKOAKNSA-N |
| XLogP | 6.36 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.71 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|