C23H40O5 — CID 10046319
ethyl (Z)-10-[(4R,5S)-5-[(Z,1S)-1-hydroxyhex-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]dec-9-enoate (PubChem CID 10046319) has the molecular formula C23H40O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is ethyl (Z)-10-[(4R,5S)-5-[(Z,1S)-1-hydroxyhex-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]dec-9-enoate.
| Compound Name | ethyl (Z)-10-[(4R,5S)-5-[(Z,1S)-1-hydroxyhex-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]dec-9-enoate |
|---|---|
| PubChem CID | 10046319 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | ethyl (Z)-10-[(4R,5S)-5-[(Z,1S)-1-hydroxyhex-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]dec-9-enoate |
| SMILES | CC/C=C\C[C@H](O)[C@@H]1OC(C)(C)O[C@@H]1/C=C\CCCCCCCC(=O)OCC |
| InChI | InChI=1S/C23H40O5/c1-5-7-13-16-19(24)22-20(27-23(3,4)28-22)17-14-11-9-8-10-12-15-18-21(25)26-6-2/h7,13-14,17,19-20,22,24H,5-6,8-12,15-16,18H2,1-4H3/b13-7-,17-14-/t19-,20+,22-/m0/s1 |
| InChIKey | BFGYNRACXULHRN-PGIYZAFPSA-N |
| XLogP | 5.07 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|