C21H40O3Si2 — CID 10046323
(3aR,5R,6S,6aS)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,3a,4,5,6,6a-hexahydropentalene-1-carbaldehyde (PubChem CID 10046323) has the molecular formula C21H40O3Si2 and a molecular weight of 396.72 g/mol. Its IUPAC name is (3aR,5R,6S,6aS)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,3a,4,5,6,6a-hexahydropentalene-1-carbaldehyde.
| Compound Name | (3aR,5R,6S,6aS)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,3a,4,5,6,6a-hexahydropentalene-1-carbaldehyde |
|---|---|
| PubChem CID | 10046323 |
| Molecular Formula | C21H40O3Si2 |
| Molecular Weight | 396.72 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (3aR,5R,6S,6aS)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3,3a,4,5,6,6a-hexahydropentalene-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H]2C(C=O)=CC[C@@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O3Si2/c1-20(2,3)25(7,8)23-17-13-15-11-12-16(14-22)18(15)19(17)24-26(9,10)21(4,5)6/h12,14-15,17-19H,11,13H2,1-10H3/t15-,17-,18+,19-/m1/s1 |
| InChIKey | GRQHPFBNRXZSOG-OQIJWPOYSA-N |
| XLogP | 5.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.72 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|