C18H21FIN — CID 10046333
5-[2-(4-fluorophenyl)ethyl]-2-methyl-5,6,7,8-tetrahydroisoquinolin-2-ium iodide (PubChem CID 10046333) has the molecular formula C18H21FIN and a molecular weight of 397.28 g/mol. Its IUPAC name is 5-[2-(4-fluorophenyl)ethyl]-2-methyl-5,6,7,8-tetrahydroisoquinolin-2-ium iodide.
| Compound Name | 5-[2-(4-fluorophenyl)ethyl]-2-methyl-5,6,7,8-tetrahydroisoquinolin-2-ium iodide |
|---|---|
| PubChem CID | 10046333 |
| Molecular Formula | C18H21FIN |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 5-[2-(4-fluorophenyl)ethyl]-2-methyl-5,6,7,8-tetrahydroisoquinolin-2-ium iodide |
| SMILES | C[n+]1ccc2c(c1)CCCC2CCc1ccc(F)cc1.[I-] |
| InChI | InChI=1S/C18H21FN.HI/c1-20-12-11-18-15(3-2-4-16(18)13-20)8-5-14-6-9-17(19)10-7-14;/h6-7,9-13,15H,2-5,8H2,1H3;1H/q+1;/p-1 |
| InChIKey | ZWLIQNSNGNQZNK-UHFFFAOYSA-M |
| XLogP | 0.71 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|