C25H20O5 — CID 10046531
(1R,15S,23S)-6-hydroxy-9,11-dimethoxy-22-oxahexacyclo[10.10.2.02,7.08,24.015,23.016,21]tetracosa-2(7),3,5,8(24),9,11,16,18,20-nonaen-13-one (PubChem CID 10046531) has the molecular formula C25H20O5 and a molecular weight of 400.43 g/mol. Its IUPAC name is (1R,15S,23S)-6-hydroxy-9,11-dimethoxy-22-oxahexacyclo[10.10.2.02,7.08,24.015,23.016,21]tetracosa-2(7),3,5,8(24),9,11,16,18,20-nonaen-13-one.
| Compound Name | (1R,15S,23S)-6-hydroxy-9,11-dimethoxy-22-oxahexacyclo[10.10.2.02,7.08,24.015,23.016,21]tetracosa-2(7),3,5,8(24),9,11,16,18,20-nonaen-13-one |
|---|---|
| PubChem CID | 10046531 |
| Molecular Formula | C25H20O5 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (1R,15S,23S)-6-hydroxy-9,11-dimethoxy-22-oxahexacyclo[10.10.2.02,7.08,24.015,23.016,21]tetracosa-2(7),3,5,8(24),9,11,16,18,20-nonaen-13-one |
| SMILES | COc1cc(OC)c2c3c1C(=O)C[C@@H]1c4ccccc4O[C@@H](c4cccc(O)c4-2)[C@H]31 |
| InChI | InChI=1S/C25H20O5/c1-28-18-11-19(29-2)23-20-13(7-5-8-15(20)26)25-21-14(10-16(27)22(18)24(21)23)12-6-3-4-9-17(12)30-25/h3-9,11,14,21,25-26H,10H2,1-2H3/t14-,21+,25+/m1/s1 |
| InChIKey | RAHLNYQUSMLHPY-XILATRJDSA-N |
| XLogP | 4.98 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |